CAS 17318-21-7
:4-AMINO-1-PYRAZOLO[3,4-D]PYRIMIDINYL 2'-DEOXYRIBONUCLEOSIDE
Description:
4-Amino-1-pyrazolo[3,4-d]pyrimidinyl 2'-deoxyribonucleoside is a nucleoside analog characterized by its structural components, which include a pyrazolo[3,4-d]pyrimidine moiety linked to a 2'-deoxyribose sugar. This compound typically exhibits properties associated with nucleosides, such as the ability to participate in nucleic acid synthesis and potential interactions with nucleic acid polymerases. The presence of the amino group at the 4-position of the pyrazolo ring can influence its biological activity, potentially enhancing its affinity for nucleic acid targets or modifying its metabolic stability. This compound may also exhibit antiviral or anticancer properties, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. As a nucleoside analog, it may interfere with normal nucleic acid processes, which is a common mechanism of action for many antiviral and anticancer agents. Further studies are often required to fully elucidate its pharmacological profile and therapeutic potential.
Formula:C10H13N5O3
InChI:InChI=1/C10H13N5O3/c11-9-5-2-14-15(10(5)13-4-12-9)8-1-6(17)7(3-16)18-8/h2,4,6-8,16-17H,1,3H2,(H2,11,12,13)
SMILES:C1C(C(CO)OC1n1c2c(cn1)c(N)ncn2)O
Synonyms:- 8-Aza-7-Deaza-2'-Deoxyadenosine (4-Amino-1-(Beta-D-2-Deoxyribofuranosyl)Pyrazolo[3,4-D]Pyrimidine)
- 1-(2-deoxypentofuranosyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(2R,3S,5S)-5-(4-Amino-1H-pyrazolo[3,4-d]pyrimidin-1-yl)-2-(hydroxymethyl)tetrahydrofuran-3-ol
CAS:Formula:C10H13N5O3Molecular weight:251.24198-Aza-7-deaza-2'-deoxyadenosine
CAS:8-Aza-7-deaza-2'-deoxyadenosine is a single-stranded DNA analogue that is used as a conjugate to deliver drugs to cells. It has been shown to be effective in the treatment of HIV by suppressing viral replication and the production of infectious virions. The drug is photolabile, which means it can be activated with light and then delivered to cells. 8-Aza-7-deaza-2'-deoxyadenosine has also been shown to inhibit the growth of human immunodeficiency virus (HIV) in vitro, but does not inhibit the growth of other viruses such as herpes simplex virus type 1 or adenovirus.
Formula:C10H13N5O3Purity:Min. 95%Color and Shape:PowderMolecular weight:251.24 g/molRef: 3D-NA141793
Discontinued product

