CAS 1732-13-4: 1,2,3,6,7,8-Hexahydropyrene
Description:1,2,3,6,7,8-Hexahydropyrene is a polycyclic aromatic hydrocarbon characterized by its saturated structure, which is derived from pyrene. This compound features six hydrogen atoms added to the pyrene framework, resulting in a fully saturated cyclic structure. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of multiple fused rings contributes to its stability and hydrophobic nature. 1,2,3,6,7,8-Hexahydropyrene is relatively insoluble in water but soluble in organic solvents, making it useful in various chemical applications. Its chemical properties include potential reactivity under certain conditions, particularly in the presence of strong oxidizing agents. The compound is of interest in research related to organic synthesis and materials science, particularly in the study of polycyclic compounds and their derivatives. Safety data indicates that, like many hydrocarbons, it should be handled with care to avoid inhalation or skin contact, as it may pose health risks.
Formula:C16H16
InChI:InChI=1S/C16H16/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h7-10H,1-6H2
InChI key:InChIKey=MBAIEZXRGAOPKH-UHFFFAOYSA-N
SMILES:C=1C=C2C=3C(=CC=C4C3C1CCC4)CCC2
- Synonyms:
- Nsc 60599
- Pyrene, 1,2,3,6,7,8-hexahydro-
- Pyrene, 1,2,3,6,7,8-hexahydro- (8CI)(9CI)
- 1,2,3,6,7,8-Hexahydropyrene
