
CAS 1733-63-7
:1,2,2-Triphenylethanone
Description:
1,2,2-Triphenylethanone, also known as benzoin, is an organic compound characterized by its structure, which features a central carbon atom bonded to two phenyl groups and a carbonyl group (C=O). This compound is typically a white to pale yellow crystalline solid with a distinctive aromatic odor. It is sparingly soluble in water but soluble in organic solvents such as ethanol and acetone. The presence of the carbonyl group contributes to its reactivity, making it useful in various chemical reactions, including photochemical processes and as a precursor in organic synthesis. 1,2,2-Triphenylethanone can undergo oxidation and reduction reactions, and it is often employed as a photoinitiator in polymerization reactions. Additionally, it has applications in the field of organic chemistry as a building block for more complex molecules. Safety considerations include handling it with care, as it may cause irritation upon contact with skin or eyes. Overall, its unique structure and properties make it a valuable compound in both academic and industrial chemistry.
Formula:C20H16O
InChI:InChI=1S/C20H16O/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15,19H
InChI key:InChIKey=UKQCJCWLKWRFFI-UHFFFAOYSA-N
SMILES:C(C(=O)C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- Acetophenone, α,α-diphenyl-
- Acetophenone, 2,2-diphenyl-
- Ethanone, 1,2,2-triphenyl-
- 1,2,2-Triphenylethanone
- Diphenylacetophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
