CAS 17331-53-2
:Thymidine, 3′-benzoate
Description:
Thymidine, 3′-benzoate, is an ester derivative of thymidine, a nucleoside that plays a crucial role in DNA synthesis. This compound features a benzoate group attached to the 3′ hydroxyl position of the thymidine molecule, which can influence its solubility and biological activity. Thymidine itself consists of a thymine base linked to a deoxyribose sugar, and the modification with a benzoate moiety can enhance its stability and alter its interaction with enzymes and receptors. The presence of the aromatic benzoate group may also impart unique properties, such as increased lipophilicity, which can affect its permeability across biological membranes. Thymidine derivatives are often studied for their potential applications in medicinal chemistry, particularly in antiviral and anticancer therapies, as they can mimic natural nucleosides and interfere with nucleic acid metabolism. The CAS number 17331-53-2 uniquely identifies this compound in chemical databases, facilitating research and regulatory processes.
Formula:C17H18N2O6
InChI:InChI=1S/C17H18N2O6/c1-10-8-19(17(23)18-15(10)21)14-7-12(13(9-20)24-14)25-16(22)11-5-3-2-4-6-11/h2-6,8,12-14,20H,7,9H2,1H3,(H,18,21,23)/t12-,13+,14+/m0/s1
InChI key:InChIKey=CZRPYTUJUAJMJJ-BFHYXJOUSA-N
SMILES:O=C1N([C@H]2C[C@H](OC(=O)C3=CC=CC=C3)[C@@H](CO)O2)C=C(C)C(=O)N1
Synonyms:- 1-[(4xi)-3-O-benzoyl-2-deoxy-beta-D-glycero-pentofuranosyl]-5-methylpyrimidine-2,4(1H,3H)-dione
- 3′-O-Benzoylthymidine
- Thymidine 3'-benzoate
- Thymidine, 3′-benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2R,3S,5R)-2-(Hydroxymethyl)-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl benzoate
CAS:(2R,3S,5R)-2-(Hydroxymethyl)-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl benzoateFormula:C17H18N2O6Purity:97%Molecular weight:346.343'-O-Benzoylthymidine
CAS:(2R,3S,5R)-2-(Hydroxymethyl)-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl benzoateFormula:C17H18N2O6Purity:97%Molecular weight:346.333'-O-Benzoylthymidine
CAS:3'-O-Benzoylthymidine is a nucleoside that is used in the synthesis of DNA. It is a monomeric compound that contains two deoxyribose sugars and one deoxyribonucleotide. 3'-O-Benzoylthymidine interacts with the phosphite triester, which stabilizes the nucleobase. This reaction leads to the formation of a glycosidic bond between the phosphate group and the 5' carbon atom in the sugar ring of 3'-O-benzoylthymidine. The chloride ion is then added to form an intermediate compound with a reactive electrophilic carbon center that can be used for subsequent reactions with other compounds or nucleobases. 3'-O-Benzoylthymidine can also be conjugated to other compounds through covalent bonds, such as phosphonates, to form more complex molecules.Formula:C17H18N2O6Purity:Min. 95%Color and Shape:PowderMolecular weight:346.34 g/mol



