CAS 17332-11-5: 2-Bromo-4-methoxyphenol

Description:2-Bromo-4-methoxyphenol, with the CAS number 17332-11-5, is an organic compound characterized by the presence of a bromine atom and a methoxy group attached to a phenolic ring. This compound typically appears as a solid or crystalline substance and is known for its aromatic properties. The bromine substituent enhances its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The methoxy group contributes to its solubility in organic solvents and can influence its biological activity. 2-Bromo-4-methoxyphenol exhibits moderate toxicity, and safety precautions should be taken when handling it. Its chemical structure allows for potential applications in research, particularly in studies involving phenolic compounds and their derivatives. Additionally, it may serve as an intermediate in the synthesis of more complex organic molecules. Overall, this compound is of interest in both industrial and academic settings due to its unique chemical properties and potential applications.

Formula:C₇H₇BrO₂

InChI:InChI=1S/C7H7BrO2/c1-10-5-2-3-7(9)6(8)4-5/h2-4,9H,1H3

InChI key:InChIKey=LTMSUXSPKZRMAB-UHFFFAOYSA-N

SMILES:BrC1=CC(OC)=CC=C1O

Synonyms:
2-Bromo-4-methoxy-phenol
2-Bromo-4-methoxybenzenol
NSC 168509
Phenol, 2-bromo-4-methoxy-
2-Bromo-4-methoxyphenol

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2-Bromo-4-methoxyphenol REF: 3B-B3135CAS: 17332-11-5	>98.0%(T)	68.00 €~203.00 €	Mon 07 Apr 25
Phenol, 2-bromo-4-methoxy- REF: IN-DA001YSXCAS: 17332-11-5	97%	To inquire	Mon 14 Apr 25
2-Bromo-4-methoxyphenol REF: 54-OR14191CAS: 17332-11-5	- - -	32.00 €~80.00 €	Tue 15 Apr 25
2-Bromo-4-methoxyphenol REF: 10-F069815CAS: 17332-11-5	97.0%	12.00 €~791.00 €	Thu 17 Apr 25
2-Bromo-4-methoxyphenol REF: 3D-FB50813CAS: 17332-11-5	Min. 95%	- - -	Discontinued product