CymitQuimica logo

CAS 173337-02-5

:

1-[4-(Aminomethyl)piperidin-1-yl]ethanone hydrochloride

Description:
1-[4-(Aminomethyl)piperidin-1-yl]ethanone hydrochloride, with the CAS number 173337-02-5, is a chemical compound characterized by its piperidine structure, which includes an aminomethyl group attached to the piperidine ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. It is often utilized in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. The presence of the piperidine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H17N2OCl
InChI:InChI=1S/C8H16N2O.ClH/c1-7(11)10-4-2-8(6-9)3-5-10;/h8H,2-6,9H2,1H3;1H
InChI key:InChIKey=VLEJUJAYKJRPHY-UHFFFAOYSA-N
SMILES:C(C)(=O)N1CCC(CN)CC1.Cl
Found 4 products.