CAS 17338-96-4
:3,9-Dihydro-8-methyl-1H-purine-2,6-dione
Description:
3,9-Dihydro-8-methyl-1H-purine-2,6-dione, also known as theobromine, is a purine derivative and a methylxanthine compound. It is characterized by its bicyclic structure, which includes a fused imidazole and pyrimidine ring. The presence of methyl groups at specific positions contributes to its unique properties. This compound is typically a white to off-white crystalline solid, soluble in water and organic solvents like ethanol and chloroform. Theobromine exhibits mild stimulant effects, similar to caffeine, and is known for its role in various biological activities, including vasodilation and diuresis. It is commonly found in cocoa beans and chocolate products, contributing to their flavor and effects. Theobromine has a relatively low toxicity in humans but can be harmful to certain animals, such as dogs and cats. Its pharmacological properties make it of interest in both food science and medicinal chemistry, where it is studied for potential therapeutic applications.
Formula:C6H6N4O2
InChI:InChI=1S/C6H6N4O2/c1-2-7-3-4(8-2)9-6(12)10-5(3)11/h1H3,(H3,7,8,9,10,11,12)
InChI key:InChIKey=RTAPDZBZLSXHQQ-UHFFFAOYSA-N
SMILES:O=C1C2=C(N=C(C)N2)NC(=O)N1
Synonyms:- 1H-Purine-2,6-dione, 3,7-dihydro-8-methyl-
- 1H-Purine-2,6-dione, 3,9-dihydro-8-methyl-
- 3,7-Dihydro-8-methyl-1H-purine-2,6-dione
- 3,9-Dihydro-8-methyl-1H-purine-2,6-dione
- 8-methyl-3,7-dihydro-1H-purine-2,6-dione
- 8-methyl-5,9-dihydro-1H-purine-2,6-dione
- NSC 162389
- NSC 22739
- Xanthine, 8-methyl-
- 8-Methylxanthine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-Purine-2,6-dione, 3,9-dihydro-8-methyl-
CAS:Formula:C6H6N4O2Color and Shape:SolidMolecular weight:166.13748-Methylxanthine
CAS:8-Methylxanthine is a metabolite of caffeine and theophylline. It has been shown to be a pro-inflammatory cytokine that stimulates the production of other pro-inflammatory cytokines such as interleukin (IL)-1β, IL-6, and tumor necrosis factor alpha (TNFα). 8-Methylxanthine is also a substrate for cytochrome P450 enzyme activity, which is responsible for metabolizing many drugs and other chemicals in the body. This compound has been detected in human liver and urine samples. 8-Methylxanthine has cytotoxic properties and may serve as an antioxidant. Mass spectrometric detection methods are used to identify this compound in biological fluids.Formula:C6H6N4O2Purity:Min. 95%Color and Shape:PowderMolecular weight:166.14 g/mol


