
CAS 17341-40-1
:Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt
Description:
Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt, identified by CAS number 17341-40-1, is a chemical compound characterized by its complex structure, which includes hydrazinium and various functional groups. This substance typically exhibits properties associated with hydrazines, such as being a potential reducing agent and having applications in organic synthesis. The presence of hydroxyl and carbonyl groups suggests it may engage in hydrogen bonding and participate in various chemical reactions, including nucleophilic attacks. Its inner salt nature indicates that it may exist in a zwitterionic form, contributing to its solubility and stability in polar solvents. The compound's unique structure may also impart specific biological activities or reactivity patterns, making it of interest in medicinal chemistry and material science. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C9H18N2O2
InChI:InChI=1S/C9H18N2O2/c1-7(2)9(13)10-11(4,5)6-8(3)12/h8,12H,1,6H2,2-5H3
InChI key:InChIKey=CKDMBDPJWHDRFQ-UHFFFAOYSA-N
SMILES:[N+]([N-]C(C(C)=C)=O)(CC(C)O)(C)C
Synonyms:- Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propen-1-yl)-, inner salt
- 1,1-Dimethyl-1-(2-hydroxypropyl)amine methacrylimide
- Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propenyl)-, hydroxide, inner salt
- Hydrazinium, 1-(2-hydroxypropyl)-1,1-dimethyl-2-(2-methyl-1-oxo-2-propenyl)-, inner salt
- Hydrazinium, 1-(2-hydroxypropyl)-2-methacryloyl-1,1-dimethyl-, hydroxide, inner salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
YPH 103
CAS:<p>YPH 103 is a biochemical.</p>Formula:C9H18N2O2Color and Shape:SolidMolecular weight:186.25
