CAS 173471-71-1

6-DIMETHYLAMINO-2-NAPHTHALDEHYDE

Description:

6-Dimethylamino-2-naphthaldehyde is an organic compound characterized by its naphthalene structure with a dimethylamino group and an aldehyde functional group. This compound typically appears as a solid or crystalline substance and is known for its vibrant color, often exhibiting strong fluorescence properties. It is primarily utilized in organic synthesis and as a reagent in various chemical reactions, particularly in the development of dyes and pigments. The presence of the dimethylamino group enhances its reactivity, making it a valuable intermediate in the synthesis of more complex organic molecules. Additionally, its aldehyde functionality allows for further derivatization, enabling its application in various fields, including pharmaceuticals and materials science. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested. Overall, 6-dimethylamino-2-naphthaldehyde is a significant compound in organic chemistry with diverse applications due to its unique structural features and reactivity.

Formula: C₁₃H₁₃NO

InChI: InChI=1/C13H13NO/c1-14(2)13-6-5-11-7-10(9-15)3-4-12(11)8-13/h3-9H,1-2H3

SMILES: CN(C)c1ccc2cc(ccc2c1)C=O

Synonyms:

• 6-Dimethylaminonaphthalene-2-Carbaldehyde
• 6-dimethylamino-2-naphthaldehyde

2-Naphthalenecarboxaldehyde, 6-(dimethylamino)-

CAS: 173471-71-1

Formula: C₁₃H₁₃NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.2484

Ref: IN-DA001YXU

6-(Dimethylamino)-2-naphthalenecarboxaldehyde

CAS: 173471-71-1

6-(Dimethylamino)-2-naphthalenecarboxaldehyde

Purity: 97%

Molecular weight: 199.25g/mol

Ref: 54-OR94070

6-(Dimethylamino)-2-naphthaldehyde

CAS: 173471-71-1

Formula: C₁₃H₁₃NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 199.253

Ref: 10-F210378