CAS 173485-80-8

L-Valine, 3-hydroxy-, (6-carboxy-4-methoxy-1-phenazinyl)methyl ester

Description:

L-Valine, 3-hydroxy-, (6-carboxy-4-methoxy-1-phenazinyl)methyl ester, identified by CAS number 173485-80-8, is a chemical compound that features a complex structure incorporating both amino acid and phenazine moieties. As a derivative of L-valine, it retains the essential characteristics of this branched-chain amino acid, which is crucial for protein synthesis and is involved in various metabolic processes. The presence of the hydroxy group and the phenazine ring contributes to its potential biological activity, possibly influencing its solubility and reactivity. The carboxy and methoxy substituents further modify its chemical properties, potentially enhancing its interaction with biological targets. This compound may be of interest in pharmaceutical research, particularly in the development of novel therapeutic agents, due to its unique structural features. However, specific applications, toxicity, and detailed biological effects would require further investigation through empirical studies. Overall, L-Valine, 3-hydroxy-, (6-carboxy-4-methoxy-1-phenazinyl)methyl ester represents a fascinating intersection of amino acid chemistry and medicinal chemistry.

Formula: C₂₀H₂₁N₃O₆

InChI: InChI=1S/C20H21N3O6/c1-20(2,27)17(21)19(26)29-9-10-7-8-13(28-3)16-14(10)22-12-6-4-5-11(18(24)25)15(12)23-16/h4-8,17,27H,9,21H2,1-3H3,(H,24,25)/t17-/m1/s1

InChI key: InChIKey=SFUOAUKIPVZJLK-QGZVFWFLSA-N

SMILES: C(OC([C@H](C(C)(C)O)N)=O)C=1C2=C(N=C3C(=N2)C=CC=C3C(O)=O)C(OC)=CC1

Synonyms:

• Pelagiomicin A
• L-Valine, 3-hydroxy-, (6-carboxy-4-methoxy-1-phenazinyl)methyl ester
• Antibiotic 2088A

Pelagiomicin A

CAS: 173485-80-8

Pelagiomicin A is used as an anticancer antibiotic produced by the marine bacterium Pelagiobacter variabilis.

Formula: C₂₀H₂₁N₃O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 399.4

Ref: TM-T25928