CAS 17351-32-5

For-Met-Ala-Ser-OH

Description:

For-Met-Ala-Ser-OH, also known by its CAS number 17351-32-5, is a synthetic peptide that consists of a sequence of amino acids, specifically phenylalanine (For), methionine (Met), alanine (Ala), and serine (Ser), followed by a carboxyl group (-OH). This compound is characterized by its potential biological activity, often studied in the context of peptide synthesis and its applications in pharmaceuticals and biochemistry. Peptides like For-Met-Ala-Ser-OH can exhibit various properties such as solubility in water, stability under physiological conditions, and the ability to interact with biological receptors. The specific sequence of amino acids contributes to its unique structural and functional characteristics, influencing its role in biological systems. Additionally, the presence of the hydroxyl group can enhance its reactivity and solubility, making it a subject of interest in drug design and therapeutic applications. Overall, For-Met-Ala-Ser-OH represents a valuable compound in the field of peptide chemistry and biomedicine.

Formula: C₁₁H₁₅ClN₂

InChI: InChI=1/C11H15ClN2/c12-11-4-2-1-3-10(11)9-14-7-5-13-6-8-14/h1-4,13H,5-9H2

SMILES: c1ccc(c(c1)CN1CCNCC1)Cl

Synonyms:

• 1-(2-Chlorobenzyl)Piperazine

For-Met-Ala-Ser-OH

CAS: 17351-32-5

fMAS was used as substrate in a continuous assay for peptide deformylase (PDF).

Formula: C₁₂H₂₁N₃O₆S

Purity: 97.4%

Molecular weight: 335.38

Ref: 01-4013146

N-Formyl-Met-Ala-Ser

CAS: 17351-32-5

N-Formyl-Met-Ala-Ser, a peptide, activates neutrophils via formyl peptide receptors.

Formula: C₁₂H₂₁N₃O₆S

Purity: 98%

Color and Shape: Solid

Molecular weight: 335.38

Ref: TM-TP1672