CymitQuimica logo

CAS 17351-61-0

:

Ethanaminium, N,N,N-triethyl-, carbonate (1:1)

Description:
Ethanaminium, N,N,N-triethyl-, carbonate (1:1), commonly referred to as triethylammonium carbonate, is an organic compound characterized by its quaternary ammonium structure. It features a triethylammonium cation and a carbonate anion, resulting in a salt formation. This compound is typically a white crystalline solid that is soluble in water and polar organic solvents, making it useful in various applications, including as a reagent in organic synthesis and as a potential electrolyte in electrochemical systems. The presence of the triethylammonium group imparts certain properties such as increased lipophilicity compared to other ammonium salts, which can influence its behavior in biological systems. Additionally, the carbonate moiety can participate in acid-base reactions, making it a versatile compound in chemical reactions. Safety data indicates that, like many ammonium salts, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, its unique structure and properties make it a compound of interest in both industrial and research settings.
Formula:C8H20NCHO3
InChI:InChI=1S/C8H20N.CH2O3/c1-5-9(6-2,7-3)8-4;2-1(3)4/h5-8H2,1-4H3;(H2,2,3,4)/q+1;/p-1
InChI key:XUBMPLUQNSSFHO-UHFFFAOYSA-M
SMILES:CC[N+](CC)(CC)CC.C(=O)(O)[O-]
Found 4 products.