CAS 173531-58-3
:Naphthoquine Phosphate
Description:
Naphthoquine phosphate is a synthetic compound primarily recognized for its application in the field of medicinal chemistry, particularly as an antimalarial agent. It is a derivative of naphthoquinone, which is characterized by its bicyclic structure containing two fused aromatic rings. The phosphate group enhances its solubility and bioavailability, making it more effective in biological systems. Naphthoquine phosphate exhibits potent activity against Plasmodium species, the parasites responsible for malaria, by interfering with their metabolic processes. Its mechanism of action typically involves the inhibition of electron transport in the mitochondria of the parasite, leading to cell death. The compound is often studied for its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, which are crucial for determining its efficacy and safety profile. Additionally, research continues into its potential use in combination therapies to combat drug-resistant strains of malaria. As with many pharmaceuticals, understanding its toxicity and side effects is essential for safe clinical application.
Formula:C24H28ClN3O.2(H3O4P)
Synonyms:- 4-[(7-Chloro-4-quinolinyl)amino]-2-[[(tert-butyl)amino]methyl]-5,6,7,8-tetrahydro-1-naphthalenol phosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Naphthoquine phosphate
CAS:Naphthoquine phosphate is an antimalarial compound that may affect viral entry and post-entry replication.Formula:C24H34ClN3O9P2Purity:99.59%Color and Shape:SolidMolecular weight:605.94

