CAS 17359-54-5

2,4-Dihydroxy-1,4-benzoxazin-3-one

Description:

2,4-Dihydroxy-1,4-benzoxazin-3-one, commonly referred to as DBMIB, is an organic compound characterized by its heterocyclic structure, which includes a benzoxazine ring. This compound features two hydroxyl groups at the 2 and 4 positions, contributing to its reactivity and potential applications in various fields. It is known for its role in plant defense mechanisms, particularly in the context of allelopathy, where it can inhibit the growth of competing plants. The compound exhibits antioxidant properties, which may be beneficial in agricultural and pharmaceutical applications. In terms of solubility, DBMIB is generally soluble in polar solvents, making it suitable for various chemical reactions and formulations. Its molecular structure allows for potential interactions with biological systems, which has led to interest in its use as a natural herbicide or in the development of new agrochemicals. Overall, 2,4-Dihydroxy-1,4-benzoxazin-3-one is a compound of significant interest due to its unique properties and potential applications in both environmental and health-related fields.

Formula: C₈H₇NO₄

InChI: InChI=1S/C8H7NO4/c10-7-8(11)13-6-4-2-1-3-5(6)9(7)12/h1-4,8,11-12H

InChI key: InChIKey=COVOPZQGJGUPEY-UHFFFAOYSA-N

SMILES: ON1C=2C(OC(O)C1=O)=CC=CC2

Synonyms:

• (±)-Diboa
• 2,4-Dihydroxy-1,4-Benzoxazinone
• 2,4-Dihydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-one
• 2,4-dihydroxy-2H-1,4-benzoxazin-3(4H)-one
• 2H-1,4-Benzoxazin-3(4H)-one, 2,4-dihydroxy-

2,4-dihydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-one

CAS: 17359-54-5

Formula: C₈H₇NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 181.1455

Ref: IN-DA001Z1E

DIBOA

Controlled Product

CAS: 17359-54-5

Applications DIBOA is an allelopathic biochemical that is produced by grasses. This benzoxazinoid compound displays health-promoting effects in rats.
References Adhikari, K. et al.: J. Agri. Food Chem., 60, 11518 (2012);

Formula: C₈H₇NO₄

Color and Shape: Neat

Molecular weight: 181.15

Ref: TR-D422730

DIBOA

CAS: 17359-54-5

DIBOA is a benzoxazinoid compound, which is a naturally occurring hydroxamic acid. It is primarily derived from certain species of the Poaceae family, particularly rye (Secale cereale) and maize (Zea mays). The mode of action of DIBOA involves its conversion into reactive intermediates, such as benzoxazolinones, which exhibit allelopathic effects. These intermediates disrupt cell processes, leading to growth inhibition in competing plant species and potential pest resistance.

Formula: C₈H₇NO₄

Purity: Min. 95%

Molecular weight: 181.15 g/mol

Ref: 3D-BD180701