CAS 173593-25-4

Dicyclohexyl-(2-Methylphenyl)Phosphine

Description:

Dicyclohexyl-(2-Methylphenyl)Phosphine is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two cyclohexyl groups and a 2-methylphenyl group. This compound typically exhibits properties associated with phosphines, such as being a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its role as a ligand in coordination chemistry, where it can stabilize metal complexes and facilitate various catalytic processes. The steric bulk provided by the cyclohexyl groups can influence the reactivity and selectivity of the metal-ligand complexes formed. Additionally, the presence of the 2-methylphenyl group can enhance solubility in organic solvents and may affect the electronic properties of the ligand. Dicyclohexyl-(2-Methylphenyl)Phosphine is typically handled with care due to potential toxicity and should be stored in a cool, dry place, away from incompatible materials. Its applications are primarily found in organic synthesis and catalysis, particularly in reactions involving transition metals.

Formula: C₁₉H₂₉P

InChI: InChI=1/C19H29P/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h8-10,15,17-18H,2-7,11-14H2,1H3

SMILES: Cc1ccccc1P(C1CCCCC1)C1CCCCC1

Synonyms:

• (O-Tolyl)Dicyclohexylphosphine
• Dicyclohexyl(2-Methylphenyl)Phosphane
• Dicyclohexyl(2-methylphenyl)phosphine

Phosphine, dicyclohexyl(2-methylphenyl)-

CAS: 173593-25-4

Formula: C₁₉H₂₉P

Purity: 95%

Color and Shape: Solid

Molecular weight: 288.4073

Ref: IN-DA001Z19

Dicyclohexyl(o-tolyl)phosphine

CAS: 173593-25-4

Dicyclohexyl(o-tolyl)phosphine

Purity: 98%

Molecular weight: 288.41g/mol

Ref: 54-OR95883

Dicyclohexyl(o-tolyl)phosphine

CAS: 173593-25-4

Formula: C₁₉H₂₉P

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 288.415

Ref: 10-F215598