CymitQuimica logo

CAS 1736-43-2

:

2,2,2-TRIFLUOROETHYL 3,4-DICHLOROPHENYLCARBAMATE

Description:
2,2,2-Trifluoroethyl 3,4-dichlorophenylcarbamate, with the CAS number 1736-43-2, is a chemical compound that belongs to the class of carbamates. It is characterized by the presence of a trifluoroethyl group, which imparts unique properties such as increased lipophilicity and stability. The compound features a dichlorophenyl moiety, which contributes to its biological activity and potential applications in agrochemicals or pharmaceuticals. Typically, carbamates are known for their use as pesticides, herbicides, or in medicinal chemistry due to their ability to inhibit certain enzymes. The trifluoroethyl group can enhance the compound's efficacy and selectivity in biological systems. In terms of physical properties, it may exhibit low volatility and moderate solubility in organic solvents, making it suitable for various formulations. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity and environmental impact. Overall, 2,2,2-trifluoroethyl 3,4-dichlorophenylcarbamate is a compound of interest in both industrial and research settings.
Formula:C9H6Cl2F3NO2
InChI:InChI=1/C9H6Cl2F3NO2/c10-6-2-1-5(3-7(6)11)15-8(16)17-4-9(12,13)14/h1-3H,4H2,(H,15,16)
InChI key:RDKOSUXOQXDVPH-UHFFFAOYSA-N
SMILES:c1cc(c(cc1N=C(O)OCC(F)(F)F)Cl)Cl
Found 3 products.