CAS 1736-56-7
:4-(Trifluoromethyl)phenylglyoxal hydrate
Description:
4-(Trifluoromethyl)phenylglyoxal hydrate is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with a trifluoromethyl group and a glyoxal moiety. The presence of the trifluoromethyl group enhances the compound's electron-withdrawing properties, which can influence its reactivity and interactions in various chemical environments. As a hydrate, it contains water molecules integrated into its crystalline structure, which can affect its solubility and stability. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its reactivity can be attributed to the aldehyde functional groups present in the glyoxal structure, making it a potential candidate for various chemical transformations, including condensation reactions. Safety considerations should be taken into account due to the presence of fluorinated groups, which can pose environmental and health risks. Overall, 4-(Trifluoromethyl)phenylglyoxal hydrate is a valuable compound in synthetic organic chemistry with specific applications driven by its unique chemical properties.
Formula:C9H7F3O3
InChI:InChI=1/C9H5F3O2.H2O/c10-9(11,12)7-3-1-6(2-4-7)8(14)5-13;/h1-5H;1H2
SMILES:c1cc(ccc1C(=O)C=O)C(F)(F)F.O
Synonyms:- Oxo[4-(Trifluoromethyl)Phenyl]Acetaldehyde Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-(Trifluoromethyl)phenylglyoxal hydrate, 98%, dry wt. basis
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H5F3O2Purity:98%Color and Shape:Powder, White to pale pink or pale greyMolecular weight:202.132-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde
CAS:Formula:C9H5F3O2Purity:95%Color and Shape:SolidMolecular weight:202.1300

