CAS 1736-70-5
:3-(Trifluoromethyl)phenylthiourea
Description:
3-(Trifluoromethyl)phenylthiourea is an organic compound characterized by the presence of a trifluoromethyl group attached to a phenyl ring, along with a thiourea functional group. Its molecular structure features a phenyl ring substituted at the meta position with a trifluoromethyl group (–CF3), which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The thiourea moiety (–NH–C(=S)–NH2) contributes to its reactivity, particularly in forming hydrogen bonds and participating in various chemical reactions, such as nucleophilic substitutions. This compound is often studied for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties and ability to interact with biological targets. Additionally, the presence of fluorine atoms enhances its stability and can affect its solubility in different solvents. Safety data should be consulted, as compounds containing fluorine and thiourea groups may pose specific health and environmental risks.
Formula:C8H6F3N2S
InChI:InChI=1/C8H6F3N2S/c9-8(10,11)6-2-1-3-7(4-6)13-5-14-12/h1-4H,12H2
SMILES:c1cc(cc(c1)N=CSN)C(F)(F)F
Synonyms:- 1-[3-(Trifluoromethyl)phenyl]-2-thiourea
- alpha,alpha,alpha-Trifluoro-m-tolylthiourea
- 1-[3-(Trifluoromethyl)Phenyl]Thiourea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Thiourea, N-[3-(trifluoromethyl)phenyl]-
CAS:Formula:C8H7F3N2SPurity:98%Color and Shape:SolidMolecular weight:220.21481-[3-(Trifluoromethyl)phenyl]-2-thiourea
CAS:1-[3-(Trifluoromethyl)phenyl]-2-thioureaPurity:97%Molecular weight:220.21g/mol[3-(trifluoromethyl)phenyl]thiourea
CAS:3-trifluoromethylphenylthiourea is a thiourea ligand that binds to the active site of bacterial DNA gyrase and topoisomerase IV. It has been shown to be effective against methicillin-resistant Staphylococcus aureus (MRSA) and Epidermidis, but not against mononuclear cells or viruses. 3-trifluoromethylphenylthiourea is also capable of binding metal cations such as copper, nickel, and zinc.
Formula:C8H7F3N2SPurity:Min. 95%Molecular weight:220.22 g/mol1-[3-(Trifluoromethyl)phenyl]-2-thiourea
CAS:Formula:C8H7F3N2SPurity:95%Color and Shape:SolidMolecular weight:220.21



