CAS 1736-71-6
:N-[2-(Trifluoromethyl)phenyl]thiourea
Description:
N-[2-(Trifluoromethyl)phenyl]thiourea is an organic compound characterized by the presence of a thiourea functional group and a trifluoromethyl-substituted phenyl ring. Its molecular structure features a thiourea moiety, which consists of a carbon atom double-bonded to a sulfur atom and single-bonded to an amine group, contributing to its potential as a versatile building block in organic synthesis. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. N-[2-(Trifluoromethyl)phenyl]thiourea is often studied for its potential applications in agrochemicals, pharmaceuticals, and materials science, particularly due to the unique electronic and steric effects imparted by the trifluoromethyl group. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H7F3N2S
InChI:InChI=1S/C8H7F3N2S/c9-8(10,11)5-3-1-2-4-6(5)13-7(12)14/h1-4H,(H3,12,13,14)
InChI key:InChIKey=FVXFFFHGYOYYQX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(NC(N)=S)C=CC=C1
Synonyms:- 1-[2-(Trifluoromethyl)Phenyl]Thiourea
- 1-[2-(Trifluoromethyl)phenyl]-2-thiourea
- 1-[4-(Trifluoromethyl)Phenyl]Thiourea
- N-[2-(Trifluoromethyl)phenyl]thiourea
- Thiourea, (2-(trifluoromethyl)phenyl)-
- Thiourea, N-(2-(trifluoromethyl)phenyl)-
- Urea, 2-thio-1-(α,α,α-trifluoro-o-tolyl)-
- [2-(Trifluoromethyl)phenyl]thiourea
- [6-(Trifluoromethyl)Pyridin-3-Yl]Methanol
- o-(Trifluoromethyl)phenylthiourea
- o-(Trifluoromethyl)phenylthiourea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Thiourea, N-[2-(trifluoromethyl)phenyl]-
CAS:Formula:C8H7F3N2SPurity:97%Color and Shape:SolidMolecular weight:220.21482-(Trifluoromethyl)phenylthiourea
CAS:2-(Trifluoromethyl)phenylthioureaFormula:C8H7F3N2SPurity:97%Color and Shape: white crystalline powderMolecular weight:220.21g/mol1-[2-(Trifluoromethyl)phenyl]-2-thiourea
CAS:Formula:C8H7F3N2SPurity:97%Color and Shape:Solid, White powderMolecular weight:220.212-(Trifluoromethyl)phenylthiourea
CAS:2-(Trifluoromethyl)phenylthiourea is a hydrolytic cleavage product of phenylthiourea. It has been shown to be an effective inhibitor of bacterial activity and is used in the production of 2-aminobenzothiazole, which is used for the synthesis of dyes and drugs. The compound is also an oxidative cyclization agent that forms peroxide and hydrochloric acid. 2-(Trifluoromethyl)phenylthiourea has been shown to have a number of biological effects, including cleavage, hydrogen peroxide formation, and condensation with sulfones.Formula:C8H7F3N2SPurity:Min. 95%Color and Shape:PowderMolecular weight:220.22 g/mol



