CAS 1736-74-9
:4-(Trifluoromethoxy)benzenemethanol
Description:
4-(Trifluoromethoxy)benzenemethanol, with the CAS number 1736-74-9, is an organic compound characterized by the presence of a trifluoromethoxy group (-O-CF3) attached to a benzene ring, which is further connected to a hydroxymethyl group (-CH2OH). This compound exhibits properties typical of aromatic alcohols, including potential solubility in polar solvents due to the hydroxyl group, while the trifluoromethoxy group can impart unique electronic and steric effects, influencing its reactivity and interactions. The trifluoromethoxy moiety is known for enhancing lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the presence of fluorine atoms often contributes to increased stability and altered physical properties, such as boiling and melting points. The compound may also exhibit hydrogen bonding capabilities due to the hydroxyl group, which can influence its behavior in various chemical environments. Overall, 4-(Trifluoromethoxy)benzenemethanol is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C8H7F3O2
InChI:InChI=1S/C8H7F3O2/c9-8(10,11)13-7-3-1-6(5-12)2-4-7/h1-4,12H,5H2
InChI key:InChIKey=ZLSOZAOCYJDPKX-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC=C(CO)C=C1
Synonyms:- 4-(Trifluoromethoxy)benzenemethanol
- 4-(Trifluoromethoxy)benzyl alcohol
- 4-Trifluoromethoxybenzyl alcohol
- Benzenemethanol, 4-(trifluoromethoxy)-
- Benzyl alcohol, p-(trifluoromethoxy)-
- [4-(Trifluoromethoxy)Phenyl]Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzenemethanol, 4-(trifluoromethoxy)-
CAS:Formula:C8H7F3O2Purity:97%Color and Shape:LiquidMolecular weight:192.13524-(Trifluoromethoxy)benzyl alcohol
CAS:4-(Trifluoromethoxy)benzyl alcoholFormula:C8H7F3O2Purity:97%Color and Shape: clear. light yellow liquidMolecular weight:192.14g/mol4-(Trifluoromethoxy)benzyl alcohol
CAS:4-(Trifluoromethoxy)benzyl alcohol is a corrosion inhibitor that inhibits the corrosion of metals. It is able to inhibit uptake of anions, such as chloride ions and nitrate ions, by passive adsorption and by forming an outer layer on the metal surface. 4-(Trifluoromethoxy)benzyl alcohol also acts as a co-solvent for anions in high concentrations, which can be used to remove them from solution. This compound has been shown to reduce the corrosion of ferric iron and copper at high concentrations. 4-(Trifluoromethoxy)benzyl alcohol may also act as a scavenger for hydroxyl radicals, which are known to cause corrosion reactions.
Formula:C8H7F3O2Purity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:192.14 g/mol4-(Trifluoromethoxy)benzyl alcohol
CAS:Formula:C8H7F3O2Purity:97.0%Color and Shape:Liquid, ClearMolecular weight:192.1374-(Trifluoromethoxy)benzyl Alcohol
CAS:Controlled ProductFormula:C8H7F3O2Color and Shape:NeatMolecular weight:192.14




