CAS 17360-25-7

N-[(4-methylphenyl)sulfonyl]valine

Description:

N-[(4-methylphenyl)sulfonyl]valine, with the CAS number 17360-25-7, is an organic compound characterized by its sulfonamide functional group, which is attached to the amino acid valine. This compound features a valine backbone, which is an essential amino acid, and a para-methylphenylsulfonyl group that enhances its chemical properties. The presence of the sulfonyl group contributes to its potential as a sulfonamide derivative, which can exhibit various biological activities, including antimicrobial properties. The compound is typically a solid at room temperature and may be soluble in polar solvents due to the presence of the sulfonyl group. Its structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry and drug design. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring and the amino acid side chain, which may affect its pharmacokinetic and pharmacodynamic profiles.

Formula: C₁₂H₁₇NO₄S

InChI: InChI=1/C12H17NO4S/c1-8(2)11(12(14)15)13-18(16,17)10-6-4-9(3)5-7-10/h4-8,11,13H,1-3H3,(H,14,15)

SMILES: CC(C)C(C(=O)O)NS(=O)(=O)c1ccc(C)cc1

Synonyms:

• valine, N-[(4-methylphenyl)sulfonyl]-

(S)-3-Methyl-2-(4-methylbenzenesulfonamido)butanoic acid

CAS: 17360-25-7

(S)-3-Methyl-2-(4-methylbenzenesulfonamido)butanoic acid

Purity: 95%

Molecular weight: 271.34g/mol

Ref: 54-OR1070424

(2S)-3-Methyl-2-(4-methylbenzenesulfonamido)butanoic acid

CAS: 17360-25-7

(2S)-3-Methyl-2-(4-methylbenzenesulfonamido)butanoic acid is a serine protease inhibitor that binds to the active site of serine proteases, such as those found in Alzheimer's Disease and other neurodegenerative diseases. The compound has been shown to inhibit amyloid beta peptide production and to have an inhibitory effect on the progression of Alzheimer's disease. It has also been shown to prevent neuronal death following traumatic brain injury. The mechanism by which (2S)-3-Methyl-2-(4-methylbenzenesulfonamido)butanoic acid inhibits amyloid beta peptide production is not yet clear, but it may be due to its ability to inhibit enzymes involved in histidine metabolism or its ability to bind with a catalytic site on the enzyme.

Formula: C₁₂H₁₇NO₄S

Purity: Min. 95%

Molecular weight: 271.33 g/mol

Ref: 3D-SAA36025