CAS 1737-68-4
:3-AMINO-6-FLUORO-1,2-DIMETHYLBENZENE
Description:
3-Amino-6-fluoro-1,2-dimethylbenzene, with the CAS number 1737-68-4, is an organic compound characterized by the presence of an amino group (-NH2) and a fluorine atom attached to a dimethyl-substituted benzene ring. This compound features a fluorine atom at the 6-position and an amino group at the 3-position of the aromatic ring, which influences its chemical reactivity and properties. The presence of the amino group makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions, while the fluorine atom can enhance its lipophilicity and stability. The dimethyl groups contribute to steric hindrance, which can affect the compound's reactivity and interaction with other molecules. This compound may be of interest in pharmaceutical research and development due to its potential biological activity, as modifications to aromatic amines can lead to various therapeutic agents. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of such substances can vary.
Formula:C8H10FN
InChI:InChI=1/C8H10FN/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,10H2,1-2H3
SMILES:Cc1c(C)c(ccc1F)N
Synonyms:- 4-Fluoro-2,3-Dimethylaniline
- 4-Fluoro-2,3-Dimethyl-Phenylamine
- 2,3-Dimethyl-4-fluoroaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Fluoro-2,3-dimethylaniline, 97%
CAS:<p>4-Fluoro-2,3-dimethylaniline is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU re</p>Formula:C8H10FNPurity:97%Color and Shape:Crystals or powder or crystalline powder, White to pale pinkMolecular weight:139.17Benzenamine, 4-fluoro-2,3-dimethyl-
CAS:Formula:C8H10FNPurity:98%Color and Shape:SolidMolecular weight:139.17013-Amino-6-fluoro-1,2-dimethylbenzene
CAS:<p>3-Amino-6-fluoro-1,2-dimethylbenzene</p>Purity:98%Molecular weight:139.17g/mol
