CAS 173725-24-1: UNDECYL 2-ACETAMIDO-2-DEOXY-3,4,6-TRI-O-ACETYL-BETA-D-GLUCOPYRANOSIDE
Description:UNDECYL 2-ACETAMIDO-2-DEOXY-3,4,6-TRI-O-ACETYL-BETA-D-GLUCOPYRANOSIDE is a glycoside derivative characterized by its complex structure, which includes a long undecyl chain and a glucopyranoside moiety. This compound features an acetylated amino sugar, specifically 2-acetamido-2-deoxy-D-glucose, where the hydroxyl groups at positions 3, 4, and 6 are acetylated, enhancing its lipophilicity and stability. The undecyl group contributes to its hydrophobic properties, making it potentially useful in applications such as drug delivery systems or as a surfactant. The presence of the acetyl groups can influence its solubility and reactivity, allowing for various chemical modifications. This compound may exhibit biological activity due to its sugar and amide functionalities, which can interact with biological membranes or receptors. Overall, its unique structural features suggest potential utility in biochemical research and pharmaceutical applications, although specific biological activities would require further investigation.
Formula:C25H43NO9
InChI:InChI=1S/C25H43NO9/c1-6-7-8-9-10-11-12-13-14-15-31-25-22(26-17(2)27)24(34-20(5)30)23(33-19(4)29)21(35-25)16-32-18(3)28/h21-25H,6-16H2,1-5H3,(H,26,27)/t21-,22-,23-,24-,25-/m1/s1
InChI key:InChIKey=JGFIEQXFILUYQO-FXEFVXDJSA-N
SMILES:O=C(OCC1OC(OCCCCCCCCCCC)C(NC(=O)C)C(OC(=O)C)C1OC(=O)C)C
- Synonyms:
- Undecyl 2-Acetamido-2-Deoxy-3,4,6-Tri-O-Acetyl-Ss-D-Glucopyranoside
- Undecyl2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranose
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, undecyl 2-(acetylamino)-2-deoxy-, 3,4,6-triacetate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Undecyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranose REF: 7W-GC2958CAS: 173725-24-1 | - - - | To inquire | Thu 27 Mar 25 |
![]() | Undecyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranose REF: 3D-DU04114CAS: 173725-24-1 | Min. 95% | 331.00 € | Wed 07 May 25 |

Ref: 7W-GC2958
Undefined size | To inquire |

Undecyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranose
Ref: 3D-DU04114
1mg | 331.00 € |