CAS 17373-89-6
:2-Hexylidenecyclopentanone
Description:
2-Hexylidenecyclopentanone is an organic compound characterized by its unique structure, which features a cyclopentanone ring with a hexylidene substituent. This compound belongs to the class of ketones, which are characterized by the presence of a carbonyl group (C=O) within their molecular structure. The presence of the hexylidene group contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. 2-Hexylidenecyclopentanone may exhibit interesting chemical reactivity due to the presence of both the carbonyl group and the alkyl chain, potentially participating in various organic reactions such as nucleophilic additions. Its physical properties, such as boiling point and melting point, are influenced by its molecular weight and structure. Additionally, this compound may have applications in the fragrance industry or as an intermediate in organic synthesis, although specific applications can vary. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C11H18O
InChI:InChI=1S/C11H18O/c1-2-3-4-5-7-10-8-6-9-11(10)12/h7H,2-6,8-9H2,1H3
InChI key:InChIKey=WZPGQHVPSKTELT-UHFFFAOYSA-N
SMILES:C(CCCCC)=C1C(=O)CCC1
Synonyms:- 2-(Hexylidene)-1-cyclopentanone
- Cyclopentanone, 2-hexylidene-
- alpha-Hexylidenecyclopentanone
- 2-Hexylidenecyclopentanone
- 2-Hexylidenecyclopentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Hexylidenecyclopentanone
CAS:Controlled ProductApplications 2-Hexylidenecyclopentanone is a compound that is found in fragrance.
References Scognamiglio, J., et al.: Food Chem. Tox., 3, S577 (2012)Formula:C11H18OColor and Shape:NeatMolecular weight:166.262-Hexylidenecyclopentanone-d4
CAS:Controlled ProductFormula:C11D4H14OColor and Shape:NeatMolecular weight:170.285
