CAS 17379-38-3
:3-(Trimethylsilyl)-4-pyridinecarbonitrile
Description:
3-(Trimethylsilyl)-4-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a cyano group (-C≡N) at the 4-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The trimethylsilyl group (-Si(CH₃)₃) at the 3-position enhances the compound's stability and solubility in organic solvents, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is often utilized in the synthesis of more complex organic molecules and may serve as a reagent in the preparation of pharmaceuticals or agrochemicals. As with many organosilicon compounds, it may exhibit unique properties such as low volatility and thermal stability, which can be advantageous in specific applications. Proper handling and storage are essential due to potential reactivity and toxicity associated with its functional groups.
Formula:C9H12N2Si
InChI:InChI=1S/C9H12N2Si/c1-12(2,3)9-7-11-5-4-8(9)6-10/h4-5,7H,1-3H3
InChI key:InChIKey=HOEFGISDEWYXLW-UHFFFAOYSA-N
SMILES:C(#N)C=1C([Si](C)(C)C)=CN=CC1
Synonyms:- 3-(Trimethylsilyl)-4-pyridinecarbonitrile
- 3-Trimethylsilyl-4-cyanopyridine
- 4-Cyano-3-(trimethylsilyl)pyridine
- 4-Pyridinecarbonitrile, 3-(Trimethylsilyl)-
- Isonicotinonitrile, 3-(trimethylsilyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Cyano-3-(trimethylsilyl)pyridine
CAS:4-Cyano-3-(trimethylsilyl)pyridine
Molecular weight:176.29g/mol

