CAS 17380-74-4
:1-Phenylcyclopentylamine
Description:
1-Phenylcyclopentylamine is an organic compound characterized by its cyclopentane ring structure substituted with a phenyl group and an amine functional group. This compound typically exhibits properties associated with both cyclic and aromatic amines, including potential solubility in organic solvents and moderate polarity. The presence of the phenyl group contributes to its aromatic characteristics, which can influence its reactivity and interaction with other chemical species. As an amine, it may participate in hydrogen bonding, affecting its boiling and melting points. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amine group that can interact with biological targets. Additionally, its unique structure may impart specific biological activities, making it of interest in research related to neurochemistry or other fields. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C11H15N
InChI:InChI=1/C11H15N/c12-11(8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9,12H2
SMILES:c1ccc(cc1)C1(CCCC1)N
Synonyms:- Cyclopentanamine, 1-phenyl-
- 1-Phenylcyclopentanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-phenylcyclopentan-1-amine
CAS:Formula:C11H15NPurity:95%Color and Shape:LiquidMolecular weight:161.24351-Phenyl-cyclopentylamine
CAS:Formula:C11H15NPurity:95.0%Color and Shape:LiquidMolecular weight:161.2481-Phenyl-cyclopentylamine
CAS:Controlled Product1-Phenyl-cyclopentylamine (1-PCPA) is an amine that is typically used in the analysis of complex reactions. It has a nanomolar range and can be detected with various analytical methods, such as in vitro studies. 1-PCPA is used to measure enzymatic activity within the micromolar range. It has a bioisosteric relationship with pentapeptide, which means it can be substituted for pentapeptide in vivo without disrupting protein function or structure. 1-PCPA also has oral toxicity and behavioral effects, making it useful for analyzing the effect of amines on sensitivity and hydrochloric acid.
Formula:C11H15NPurity:Min. 95%Molecular weight:161.25 g/mol


