CAS 17380-77-7
:1-Phenylcyclobutylamine
Description:
1-Phenylcyclobutylamine is an organic compound characterized by its cyclobutane ring structure fused with a phenyl group and an amine functional group. This compound typically exhibits a molecular structure that allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Its amine group can participate in hydrogen bonding, influencing its solubility and reactivity. The presence of the phenyl group contributes to its aromatic characteristics, which can affect its electronic properties and stability. 1-Phenylcyclobutylamine may also exhibit chirality, depending on the specific stereochemistry of the cyclobutane ring, leading to potential variations in biological activity. The compound's properties, such as boiling point, melting point, and reactivity, are influenced by its molecular structure and functional groups. As with many amines, it may have basic properties, allowing it to act as a proton acceptor in various chemical reactions. Overall, 1-Phenylcyclobutylamine is a compound of interest for further study in both synthetic and pharmaceutical chemistry contexts.
Formula:C10H13N
InChI:InChI=1/C10H13N/c11-10(7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8,11H2
SMILES:c1ccc(cc1)C1(CCC1)N
Synonyms:- 1-Pcba
- Cyclobutanamine, 1-phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-phenylcyclobutan-1-amine
CAS:Formula:C10H13NPurity:97%Color and Shape:LiquidMolecular weight:147.21691-Phenylcyclobutylamine
CAS:1-Phenylcyclobutylamine is a reactive molecule that can undergo radical reactions. The radical mechanism is one of the main classes of chemical reactions. 1-Phenylcyclobutylamine reacts with oxygen to form hydroperoxide and hydrogen peroxide. It also reacts with other molecules such as flavin and cytochrome P450, which are important for the metabolism of drugs in the body. 1-Phenylcyclobutylamine has been shown to inhibit the activity of cyclopropylamine, which is an inhibitor of cytochrome P450 enzymes. Inhibition by 1-phenylcyclobutylamine may be due to its ability to form free radicals or directly react with other substances in the body.Formula:C10H13NPurity:Min. 95%Molecular weight:147.22 g/mol



