CAS 173838-63-6
:4-[4-(3-PYRIDYL)IMIDAZOL-1-YL]BUTYLAMINE TRIHCl
Description:
4-[4-(3-Pyridyl)imidazol-1-yl]butylamine trihydrochloride is a chemical compound characterized by its complex structure, which includes a pyridine ring and an imidazole moiety. This compound typically exhibits properties associated with both basic and aromatic functionalities due to the presence of nitrogen atoms in its rings. It is often utilized in biochemical research and pharmaceutical applications, particularly in studies related to receptor interactions or as a potential therapeutic agent. The trihydrochloride form indicates that the compound is protonated, enhancing its solubility in aqueous environments, which is advantageous for biological assays. Its molecular structure suggests potential interactions with various biological targets, making it a subject of interest in medicinal chemistry. Additionally, the presence of the butylamine chain may influence its pharmacokinetic properties, such as permeability and bioavailability. As with many nitrogen-containing compounds, it may exhibit basicity, allowing it to participate in various chemical reactions or interactions in biological systems.
Formula:C12H16N4
InChI:InChI=1/C12H16N4/c13-5-1-2-7-16-9-12(15-10-16)11-4-3-6-14-8-11/h3-4,6,8-10H,1-2,5,7,13H2
InChI key:PZFFSGZBQUSNGT-UHFFFAOYSA-N
SMILES:C(CCn1cc(c2cccnc2)nc1)CN
Synonyms:- 4-(3-Pyridinyl)-1H-Imidazol-1-Butanamine
- 4-[4-(3-Pyridyl)imidazol-1-yl]butylamine
- 4-4-Pyridin-3-yl-imidazol-1-ylbutylamine
- 4-(4-pyridin-3-yl-1H-imidazol-1-yl)butan-1-amine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
