CAS 173852-01-2
:(4-but-3-enylphenyl) acetate
Description:
(4-but-3-enylphenyl) acetate, with the CAS number 173852-01-2, is an organic compound characterized by its ester functional group, which is formed from the reaction of acetic acid and a phenolic compound. This substance features a phenyl ring substituted with a but-3-enyl group at the para position, contributing to its unique reactivity and potential applications in organic synthesis. The presence of the double bond in the but-3-enyl moiety can facilitate various chemical reactions, such as polymerization or cross-coupling reactions. Typically, compounds like this exhibit moderate volatility and may have a distinct odor, often associated with aromatic compounds. Its solubility in organic solvents, such as ethanol or ether, is expected, while its solubility in water is likely limited due to the hydrophobic nature of the phenyl and but-3-enyl groups. The compound may be utilized in the synthesis of more complex molecules or as an intermediate in various chemical processes, highlighting its importance in organic chemistry and industrial applications.
Formula:C12H14O2
InChI:InChI=1/C12H14O2/c1-3-4-5-11-6-8-12(9-7-11)14-10(2)13/h3,6-9H,1,4-5H2,2H3
SMILES:C=CCCc1ccc(cc1)OC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
