CymitQuimica logo

CAS 173864-47-6

:

ethyl (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate

Description:
Ethyl (2R,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylate is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and various substituents that contribute to its chemical properties. The presence of the benzodioxole moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound features stereocenters, indicated by the (2R,3R,4S) configuration, which can influence its biological activity and pharmacokinetics. The ethyl ester functional group enhances its solubility and may affect its reactivity. Additionally, the methoxyphenyl group can provide hydrophobic interactions, potentially influencing the compound's binding affinity to receptors or enzymes. Overall, this compound's unique structural features may lead to interesting biological activities, making it a subject of interest in drug discovery and development.
Formula:C21H23NO5
InChI:InChI=1/C21H23NO5/c1-3-25-21(23)19-16(14-6-9-17-18(10-14)27-12-26-17)11-22-20(19)13-4-7-15(24-2)8-5-13/h4-10,16,19-20,22H,3,11-12H2,1-2H3/t16-,19-,20+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.