CAS 17388-71-5

Z-Trp-Ala-OH

Description:

Z-Trp-Ala-OH, also known as Z-tryptophan-alanine, is a dipeptide derivative where the amino acid tryptophan is protected at its amino group by a benzyloxycarbonyl (Z) group, and it is linked to alanine. This compound is characterized by its structure, which includes the indole side chain of tryptophan, contributing to its unique properties, such as potential interactions in biological systems and applications in peptide synthesis. The Z group serves to protect the amino group during chemical reactions, allowing for selective modifications. Z-Trp-Ala-OH is often utilized in research and pharmaceutical applications, particularly in the study of peptide behavior, synthesis, and the development of bioactive compounds. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in experimental setups. As with many peptides, it may exhibit specific biological activities, including potential roles in neurotransmission or as precursors to larger peptide structures.

Formula: C₂₂H₂₃N₃O₅

InChI: InChI=1/C22H23N3O5/c1-14(21(27)28)24-20(26)19(11-16-12-23-18-10-6-5-9-17(16)18)25-22(29)30-13-15-7-3-2-4-8-15/h2-10,12,14,19,23H,11,13H2,1H3,(H,24,26)(H,25,29)(H,27,28)

SMILES: CC(C(=O)O)N=C(C(Cc1c[nH]c2ccccc12)N=C(O)OCc1ccccc1)O

Synonyms:

• N-[(benzyloxy)carbonyl]tryptophylalanine

Z-Trp-Ala-OH

CAS: 17388-71-5

Z-Trp-Ala-OH is an imidazolide that is used as a potassium supplement. It has the potential to be used in the treatment of epilepsy, but more research is needed to determine its safety and efficacy.

Formula: C₂₂H₂₃N₃O₅

Purity: Min. 95%

Molecular weight: 409.44 g/mol

Ref: 3D-FT111516