CAS 17388-96-4
:3-[(2S)-2-amino-2-carboxyethyl]-2-oxo-2H-pyran-6-carboxylic acid
Description:
The chemical substance known as 3-[(2S)-2-amino-2-carboxyethyl]-2-oxo-2H-pyran-6-carboxylic acid, with the CAS number 17388-96-4, is a pyran derivative that features a complex structure characterized by multiple functional groups. It contains an amino acid moiety, specifically an L-alanine derivative, which contributes to its biological activity. The presence of carboxylic acid groups indicates that it can participate in acid-base reactions, while the keto group in the pyran ring suggests potential reactivity in nucleophilic addition reactions. This compound is likely to exhibit polar characteristics due to its multiple functional groups, which may enhance its solubility in polar solvents. Additionally, the stereochemistry indicated by the (2S) configuration suggests that it may have specific interactions in biological systems, potentially influencing its pharmacological properties. Overall, this compound may be of interest in medicinal chemistry and biochemistry due to its structural features and potential biological activities.
Formula:C9H9NO6
InChI:InChI=1/C9H9NO6/c10-5(7(11)12)3-4-1-2-6(8(13)14)16-9(4)15/h1-2,5H,3,10H2,(H,11,12)(H,13,14)/t5-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
