CAS 1739-83-9
:1,2,4,5-Tetramethyl-1H-imidazole
Description:
1,2,4,5-Tetramethyl-1H-imidazole is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This particular derivative features four methyl groups attached to the ring, specifically at the 1, 2, 4, and 5 positions, which significantly influence its chemical properties and reactivity. The presence of these methyl groups enhances the compound's lipophilicity and can affect its solubility in various solvents. 1,2,4,5-Tetramethyl-1H-imidazole is known for its potential applications in organic synthesis and as a ligand in coordination chemistry due to the nitrogen atoms' ability to coordinate with metal ions. Additionally, it may exhibit interesting biological activities, although specific studies on its pharmacological properties may be limited. The compound is typically handled with standard safety precautions, as with many organic chemicals, to mitigate any potential hazards associated with its use.
Formula:C7H12N2
InChI:InChI=1S/C7H12N2/c1-5-6(2)9(4)7(3)8-5/h1-4H3
InChI key:InChIKey=WLUJHMKCLOIRSK-UHFFFAOYSA-N
SMILES:CC=1N(C)C(C)=NC1C
Synonyms:- 1,2,4,5-Tetramethylimidazole
- 1,2,4,5-tetramethyl-1H-imidazole
- 1H-Imidazole, 1,2,4,5-tetramethyl-
- Imidazole, 1,2,4,5-tetramethyl-
- Tetramethylimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Imidazole, 1,2,4,5-tetramethyl-
CAS:Formula:C7H12N2Purity:95%Color and Shape:SolidMolecular weight:124.18361,2,4,5-Tetramethylimidazole
CAS:Formula:C7H12N2Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:124.191,2,4,5-Tetramethylimidazole
CAS:<p>1,2,4,5-Tetramethylimidazole is a synthetic organic compound that has been used to synthesize polymers. It is chemically stable in the presence of primary amines and other compounds that can form hydrogen bonds. 1,2,4,5-Tetramethylimidazole has been shown to be useful as a matrix polymer because it can undergo free radical polymerization with various functional groups. It can also react with anions such as nitrate or chloride ion to form ionic complexes. Thermally, 1,2,4,5-tetramethylimidazole decomposes into ammonia and methanol at temperatures above 200°C.</p>Formula:C7H12N2Purity:Min. 95%Molecular weight:124.19 g/mol




