CAS 1739-83-9: 1,2,4,5-Tetramethyl-1H-imidazole

Description:1,2,4,5-Tetramethyl-1H-imidazole is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This particular derivative features four methyl groups attached to the ring, specifically at the 1, 2, 4, and 5 positions, which significantly influence its chemical properties and reactivity. The presence of these methyl groups enhances the compound's lipophilicity and can affect its solubility in various solvents. 1,2,4,5-Tetramethyl-1H-imidazole is known for its potential applications in organic synthesis and as a ligand in coordination chemistry due to the nitrogen atoms' ability to coordinate with metal ions. Additionally, it may exhibit interesting biological activities, although specific studies on its pharmacological properties may be limited. The compound is typically handled with standard safety precautions, as with many organic chemicals, to mitigate any potential hazards associated with its use.

Formula:C₇H₁₂N₂

InChI:InChI=1S/C7H12N2/c1-5-6(2)9(4)7(3)8-5/h1-4H3

InChI key:InChIKey=WLUJHMKCLOIRSK-UHFFFAOYSA-N

SMILES:N=1C(=C(N(C1C)C)C)C

Synonyms:
1,2,4,5-Tetramethylimidazole
1,2,4,5-tetramethyl-1H-imidazole
1H-Imidazole, 1,2,4,5-tetramethyl-
Imidazole, 1,2,4,5-tetramethyl-
Tetramethylimidazole

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1,2,4,5-Tetramethylimidazole REF: 3B-T0971CAS: 1739-83-9	>98.0%(GC)(T)	271.00 €~868.00 €	Thu 20 Mar 25
1H-Imidazole, 1,2,4,5-tetramethyl- REF: IN-DA001Z9ZCAS: 1739-83-9	95%	To inquire	Thu 27 Mar 25
1,2,4,5-Tetramethylimidazole REF: 54-OR919739CAS: 1739-83-9	95%	52.00 €~2,358.00 €	Fri 28 Mar 25
1,2,4,5-Tetramethyl-1H-imidazole REF: 10-F689770CAS: 1739-83-9	95%	To inquire	Tue 08 Apr 25
1,2,4,5-Tetramethylimidazole REF: 3D-BAA73983CAS: 1739-83-9	Min. 95%	To inquire	Thu 08 May 25