CAS 173900-46-4

Propanoic acid, 2,2-difluoro-, anhydride with 2,2-difluoropropanoic acid

Description:

Propanoic acid, 2,2-difluoro-, anhydride with 2,2-difluoropropanoic acid, identified by CAS number 173900-46-4, is a chemical compound characterized by its unique structure that includes two fluorine atoms attached to the propanoic acid backbone. This compound is an anhydride, indicating that it is formed from the dehydration of two carboxylic acid molecules, which in this case are both 2,2-difluoropropanoic acids. The presence of fluorine atoms typically enhances the compound's reactivity and can influence its physical properties, such as boiling point and solubility. The anhydride form suggests that it may be used in various chemical reactions, particularly in organic synthesis, where it can act as an acylating agent. Additionally, the fluorinated nature of the compound may impart unique characteristics, such as increased lipophilicity or altered biological activity, making it of interest in pharmaceutical and agrochemical applications. Safety and handling precautions should be observed due to the potential reactivity and toxicity associated with fluorinated compounds.

Formula: C₆H₆F₄O₃

InChI: InChI=1S/C6H6F4O3/c1-5(7,8)3(11)13-4(12)6(2,9)10/h1-2H3

InChI key: InChIKey=XKJXNFVMEATXPN-UHFFFAOYSA-N

SMILES: O(C(C(C)(F)F)=O)C(C(C)(F)F)=O

Synonyms:

• Propanoic acid, 2,2-difluoro-, anhydride
• Propanoic acid, 2,2-difluoro-, anhydride with 2,2-difluoropropanoic acid
• α,α-Difluoropropionic anhydride
• 2,2-Difluoropropionic anhydride

2,2-Difluoropropionic anhydride

CAS: 173900-46-4

2,2-Difluoropropionic anhydride

Purity: ≥95%

Molecular weight: 202.10g/mol

Ref: 54-PC99039