CymitQuimica logo

CAS 173901-03-6

:

(R)-1-(Pyrid-3-yl)-2-chloroethanol

Description:
(R)-1-(Pyrid-3-yl)-2-chloroethanol is a chiral organic compound characterized by the presence of a pyridine ring and a chloroethanol moiety. The compound features a stereocenter at the carbon atom adjacent to the chloro group, which contributes to its chirality, allowing for the existence of two enantiomers. The pyridine ring, a six-membered aromatic heterocycle containing one nitrogen atom, imparts basicity and potential for coordination with metal ions, making it useful in various chemical reactions and applications. The chloroethanol part of the molecule suggests reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its solubility in polar solvents, such as water and alcohols, is expected due to the presence of the hydroxyl group. Overall, (R)-1-(Pyrid-3-yl)-2-chloroethanol is of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C7H8ClNO
InChI:InChI=1/C7H8ClNO/c8-4-7(10)6-2-1-3-9-5-6/h1-3,5,7,10H,4H2/t7-/m0/s1
SMILES:c1cc(cnc1)[C@H](CCl)O
Synonyms:
  • (R)-1-(Pyrid-3-Yl)-2-Chloroethan-1-Ol
  • (R)-2-Chloro-1-(3'-Pyridyl)-1-Ethanol
  • (1R)-2-chloro-1-(pyridin-3-yl)ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.