CymitQuimica logo

CAS 17396-35-9

:

1,1-Dioxo-tetrahydro-thiopyran-4-one

Description:
1,1-Dioxo-tetrahydro-thiopyran-4-one, identified by its CAS number 17396-35-9, is a heterocyclic compound featuring a thiopyran ring structure. This compound is characterized by the presence of a dioxo functional group, which contributes to its reactivity and potential applications in organic synthesis. The thiopyran ring consists of five members, including one sulfur atom, which imparts unique chemical properties, such as the ability to participate in various nucleophilic and electrophilic reactions. The presence of the carbonyl groups enhances its electrophilic character, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting biological activities, although specific studies on its pharmacological properties may be limited. Its stability, solubility, and reactivity can vary depending on the conditions, such as solvent and temperature. Overall, 1,1-Dioxo-tetrahydro-thiopyran-4-one represents a valuable structure in the field of organic chemistry, particularly in the development of new synthetic pathways and potential therapeutic agents.
Formula:C5H8O3S
InChI:InChI=1/C5H8O3S/c6-5-1-3-9(7,8)4-2-5/h1-4H2
InChI key:XFMQGQAAHOGFQS-UHFFFAOYSA-N
SMILES:C1CS(=O)(=O)CCC1=O
Synonyms:
  • Tetrahydrothiopyran-4-one 1,1-dioxide
  • Tetrahydrothiopyran-4-one S,S-dioxide
  • tetrahydro-4H-thiopyran-4-one 1,1-dioxide
  • 1,1-dioxo-tetrahydro-thiopyran-4-one
Found 5 products.