CAS 173963-93-4
:(S)-N-FMOC-4-Cyanophenylalanine
Description:
(S)-N-FMOC-4-Cyanophenylalanine is a derivative of the amino acid phenylalanine, modified to include a 4-cyanophenyl group and a fluorenylmethyloxycarbonyl (FMOC) protecting group. This compound is characterized by its chiral nature, with the (S) configuration indicating the specific spatial arrangement of its atoms. The FMOC group serves as a protective moiety for the amino group, facilitating its use in peptide synthesis by preventing unwanted reactions during coupling processes. The presence of the cyanophenyl group enhances the compound's hydrophobicity and can influence its interactions in biological systems. This compound is often utilized in the field of peptide chemistry and drug development, particularly in the synthesis of peptides with specific functionalities. Its stability under standard laboratory conditions and compatibility with various coupling reagents make it a valuable building block in the synthesis of complex peptides. Additionally, the compound's unique structural features may contribute to its potential applications in medicinal chemistry and biochemistry.
Formula:C25H20N2O4
InChI:InChI=1/C25H20N2O4/c26-14-17-11-9-16(10-12-17)13-23(24(28)29)27-25(30)31-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22-23H,13,15H2,(H,27,30)(H,28,29)/t23-/m0/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@@H](Cc1ccc(cc1)C#N)C(=O)O)O
Synonyms:- Fmoc-L-4-Cyanophenylalanine
- Fmoc-4-Cyano-L-phenylalanine
- Fmoc-Phe(4-CN)-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
L-Phenylalanine, 4-cyano-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
CAS:Formula:C25H20N2O4Purity:97%Color and Shape:SolidMolecular weight:412.4373Fmoc-Phe(4-CN)-OH
CAS:Fmoc-Phe(4-CN)-OH is an N-Fmoc protected phenylalanine derivative and potentially useful synthetic intermediateFormula:C25H20N2O4Purity:99.45%Color and Shape:White PowderMolecular weight:412.44(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-cyanophenyl)propanoic acid
CAS:Formula:C25H20N2O4Purity:95%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:412.445Fmoc-4-cyano-Phe-OH
CAS:Derivative for introducing the fluorophore p-cyanophenylalanine during Fmoc-SPPS. Educt for the synthesis of Fmoc-p-amidino-phenylalanine, which can be used for introducing an arginine mimetic.Formula:C25H20N2O4Purity:97.4%Color and Shape:White PowderMolecular weight:412.45





