CAS 17397-24-9
:(S)-2-Hydroxyhex-5-ene
Description:
(S)-2-Hydroxyhex-5-ene, with the CAS number 17397-24-9, is an organic compound characterized by its structure as an alkenol, which features both a hydroxyl (-OH) group and a double bond within a six-carbon chain. The presence of the hydroxyl group indicates that it is an alcohol, while the double bond suggests it is an unsaturated compound. The "(S)" designation refers to its specific stereochemistry, indicating that it has a particular three-dimensional arrangement of atoms that is important for its chemical behavior and interactions. This compound is likely to exhibit properties typical of alkenols, such as reactivity in addition reactions due to the double bond and potential hydrogen bonding due to the hydroxyl group. It may also participate in various chemical reactions, including oxidation and dehydration, depending on the conditions. Its applications could span areas such as organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing, although specific uses may vary based on its reactivity and stability.
Formula:C6H12O
InChI:InChI=1/C6H12O/c1-3-4-5-6(2)7/h3,6-7H,1,4-5H2,2H3/t6-/m0/s1
SMILES:C=CCC[C@H](C)O
Synonyms:- (2S)-hex-5-en-2-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-(+)-2-Hydroxyhex-5-ene
CAS:(S)-(+)-2-Hydroxyhex-5-enePurity:≥95%Color and Shape:Colourless LiquidMolecular weight:100.16g/mol(2S)-5-Hexen-2-ol
CAS:5-Hexen-2-ol is a constituent of various natural products such as the racemosum and macrocyclic lactones. It has been found to have a broad spectrum of biological activities, including antibacterial, antifungal, antiparasitic and antimalarial activity. 5-Hexen-2-ol has also been used in the synthesis of various macrocyclic lactones and macrolactones. This compound has been found to inhibit penicillium growth by competitive inhibition of ergosterol biosynthesis.
Formula:C6H12OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:100.16 g/mol(S)-(+)-5-Hexen-2-ol (~90%)
CAS:Controlled ProductFormula:C6H12OPurity:~90%Color and Shape:NeatMolecular weight:100.16



