CAS 17397-93-2
:Tanshinone IIB
Description:
Tanshinone IIB is a bioactive compound primarily derived from the roots of the Salvia miltiorrhiza plant, commonly known as Danshen. It belongs to the class of compounds known as diterpenes and is characterized by its unique chemical structure, which includes a fused ring system. Tanshinone IIB exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and cardioprotective effects, making it of significant interest in medicinal chemistry and pharmacology. The compound has been studied for its potential therapeutic applications in cardiovascular diseases, cancer, and neurodegenerative disorders. Its mechanism of action often involves the modulation of various signaling pathways and the inhibition of specific enzymes. Tanshinone IIB is typically found in the form of a yellowish powder and is soluble in organic solvents but has limited solubility in water. Due to its promising biological activities, ongoing research continues to explore its efficacy and safety in clinical settings, as well as its potential as a natural therapeutic agent.
Formula:C19H18O4
InChI:InChI=1S/C19H18O4/c1-10-8-23-18-12-5-6-13-11(4-3-7-19(13,2)9-20)15(12)17(22)16(21)14(10)18/h5-6,8,20H,3-4,7,9H2,1-2H3/t19-/m1/s1
InChI key:InChIKey=XDUXBBDRILEIEZ-LJQANCHMSA-N
SMILES:O=C1C=2C(C3=C(C1=O)C(C)=CO3)=CC=C4C2CCC[C@@]4(CO)C
Synonyms:- Tanshinone IIB
- (6S)-6,7,8,9-Tetrahydro-6-(hydroxymethyl)-1,6-dimethylphenanthro[1,2-b]furan-10,11-dione
- Phenanthro[1,2-b]furan-10,11-dione, 6,7,8,9-tetrahydro-6-(hydroxymethyl)-1,6-dimethyl-, (6S)-
- Tanshinon IIB
- Phenanthro[1,2-b]furan-10,11-dione, 6,7,8,9-tetrahydro-6-(hydroxymethyl)-1,6-dimethyl-, (S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenanthro[1,2-b]furan-10,11-dione, 6,7,8,9-tetrahydro-6-(hydroxymethyl)-1,6-dimethyl-, (6S)-
CAS:Formula:C19H18O4Molecular weight:310.3438Tanshinone IIB
CAS:TSB reduces DNA damage, cytotoxicity, and apoptosis in rat neurons, balances Bax, bcl-2, caspase-3 proteins, and has potential for treating stroke.Formula:C19H18O4Purity:98%Color and Shape:SolidMolecular weight:310.349Tanshinone IIB
CAS:Tanshinone IIB is a diterpenoid quinone compound, which is derived from the roots of the plant Salvia miltiorrhiza, commonly known as Danshen. This compound is characterized by its intricate molecular structure, which imparts specific biological activities. Tanshinone IIB primarily acts by modulating multiple signaling pathways, including anti-inflammatory and antioxidant mechanisms, thereby influencing various cellular processes.Formula:C19H18O4Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:310.34 g/mol




