CAS 173999-18-3
:5-Methylpyridine-3-boronic acid
Description:
5-Methylpyridine-3-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound features a methyl group at the 5-position of the pyridine, which influences its reactivity and solubility. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, making it useful in various chemical reactions. The boronic acid group is known for its ability to form reversible covalent bonds with diols, which is significant in applications such as Suzuki coupling reactions in organic synthesis. Additionally, this compound may exhibit properties that allow it to act as a ligand in coordination chemistry or as a precursor in the synthesis of more complex organic molecules. Its unique structure and functional groups make it valuable in medicinal chemistry and materials science, particularly in the development of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as with all boronic acids, due to potential irritant properties.
Formula:C6H8BNO2
InChI:InChI=1/C6H8BNO2/c1-5-2-6(7(9)10)4-8-3-5/h2-4,9-10H,1H3
SMILES:Cc1cc(cnc1)B(O)O
Synonyms:- 5-Methyl-3-Pyridineboronic Acid
- (5-Methyl-3-Pyridinyl)-Boronic Acid
- (5-Methylpyridin-3-Yl)Boronic Acid
- Boronic acid, (5-methyl-3-pyridinyl)- (9CI)
- 5-Methylpyridine-3-Boronic
- (5-Methyl-3-Pyridinyl)-Boronic Aci
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Methylpyridine-3-boronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H8BNO2Purity:98%Color and Shape:White to pale brown, PowderMolecular weight:136.95Boronic acid, B-(5-methyl-3-pyridinyl)-
CAS:Formula:C6H8BNO2Purity:97%Color and Shape:SolidMolecular weight:136.94425-Methylpyridine-3-boronic acid
CAS:5-Methylpyridine-3-boronic acidFormula:C6H8BNO2Purity:97%Color and Shape: white powderMolecular weight:136.94g/mol5-Methylpyridine-3-boronic acid
CAS:Formula:C6H8BNO2Purity:95%Color and Shape:SolidMolecular weight:136.95



