CymitQuimica logo

CAS 174-77-6

:

2,6-diazaspiro[3.3]heptane

Description:
2,6-Diazaspiro[3.3]heptane, with the CAS number 174-77-6, is a bicyclic organic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a seven-membered ring system. This compound features a spiro connection between two cyclopentane-like rings, resulting in a rigid and three-dimensional molecular geometry. It is typically colorless to pale yellow and may exhibit a distinct amine-like odor. The presence of nitrogen atoms contributes to its basicity and potential reactivity, making it of interest in various chemical applications, including as a building block in organic synthesis and in the development of pharmaceuticals. Its solubility in polar solvents and limited solubility in non-polar solvents reflect its polar nature due to the nitrogen atoms. Additionally, 2,6-diazaspiro[3.3]heptane may participate in hydrogen bonding, influencing its physical properties and interactions with other molecules. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H10N2
InChI:InChI=1/C5H10N2/c1-5(2-6-1)3-7-4-5/h6-7H,1-4H2
SMILES:C1C2(CN1)CNC2
Synonyms:
  • 2,6-Diazaspiro[3.3]heptan
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.