CymitQuimica logo

CAS 1740-22-3

:

α-[3-(Di-2-pyridinylmethylene)-2,4-cyclopentadien-1-yl]-α-2-pyridinyl-2-pyridinemethanol

Description:
The chemical substance α-[3-(Di-2-pyridinylmethylene)-2,4-cyclopentadien-1-yl]-α-2-pyridinyl-2-pyridinemethanol, with CAS number 1740-22-3, is a complex organic compound characterized by its unique structure that includes multiple pyridine rings and a cyclopentadiene moiety. This compound typically exhibits properties associated with coordination chemistry, often acting as a ligand due to the presence of nitrogen atoms in the pyridine rings, which can coordinate with metal ions. Its molecular structure suggests potential applications in catalysis, organic synthesis, and materials science. The presence of hydroxyl groups may also impart solubility in polar solvents and influence its reactivity. Additionally, the compound's stability and behavior in various chemical environments can be affected by factors such as pH and the presence of other ions or molecules. Overall, this substance represents a fascinating area of study within coordination chemistry and organic synthesis, with potential implications in various fields, including medicinal chemistry and materials development.
Formula:C27H20N4O
InChI:InChI=1S/C27H20N4O/c32-27(24-11-3-7-17-30-24,25-12-4-8-18-31-25)21-14-13-20(19-21)26(22-9-1-5-15-28-22)23-10-2-6-16-29-23/h1-19,32H
InChI key:InChIKey=NCZXKYCNHGRFHE-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(=C(C2=CC=CC=N2)C3=CC=CC=N3)C=C1)(C4=CC=CC=N4)C5=CC=CC=N5
Synonyms:
  • α-[3-(Di-2-pyridinylmethylene)-2,4-cyclopentadien-1-yl]-α-2-pyridinyl-2-pyridinemethanol
  • 2-Pyridinemethanol, α-[3-(di-2-pyridinylmethylene)-2,4-cyclopentadien-1-yl]-α-2-pyridinyl-
  • 1,4-Cyclopentadiene-1-methanol, 3-(di-2-pyridylmethylene)-α,α-di-2-pyridyl-
  • 2-Pyridinemethanol, α-[3-(di-2-pyridinylmethylene)-1,4-cyclopentadien-1-yl]-α-2-pyridinyl-
  • McN 1210
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.