CAS 17400-34-9: N-Z-1,3-diaminopropane hydrochloride
Description:N-Z-1,3-diaminopropane hydrochloride, with the CAS number 17400-34-9, is a chemical compound characterized by its structure as a diamine derivative of propylene. It features two amino groups (-NH2) attached to a three-carbon propane backbone, making it a primary amine. The hydrochloride form indicates that the compound is in its salt form, which enhances its solubility in water and stability. This compound is typically a white crystalline solid and is hygroscopic, meaning it can absorb moisture from the air. N-Z-1,3-diaminopropane hydrochloride is often used in various applications, including organic synthesis, as a building block in pharmaceuticals, and in the production of polymers and resins. Its reactivity is primarily due to the presence of the amino groups, which can participate in various chemical reactions, such as acylation and alkylation. Safety precautions should be taken when handling this compound, as with many amines, due to potential irritant properties.
Formula:C11H17ClN2O2
InChI:InChI=1/C11H16N2O2.ClH/c12-7-4-8-13-11(14)15-9-10-5-2-1-3-6-10;/h1-3,5-6H,4,7-9,12H2,(H,13,14);1H
- Synonyms:
- N-Carbobenzoxy-1,3-diaminopropane hydrochloride
- N-Z-1,3-propanediamine hydrochloride
- Benzyl (3-Aminopropyl)Carbamate
- Benzyl (3-Aminopropyl)Carbamate Hydrochloride (1:1)
- N-Cbz-1,3-diaminopropane HCl
