CAS 17401-15-9
:(2-METHYL-4-PHENYLQUINOLIN-3-YL)ACETIC ACID HYDROCHLORIDE
Description:
(2-Methyl-4-phenylquinolin-3-yl)acetic acid hydrochloride, with the CAS number 17401-15-9, is a chemical compound characterized by its quinoline structure, which features a methyl group and a phenyl group attached to the quinoline ring. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, which is indicative of its acidic functional group. The presence of the acetic acid moiety suggests that it can participate in acid-base reactions, making it relevant in various chemical applications. Its hydrochloride form indicates that it is a salt, which often enhances its stability and solubility. This compound may exhibit biological activity, potentially making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C18H14NO2
InChI:InChI=1/C18H15NO2/c1-12-15(11-17(20)21)18(13-7-3-2-4-8-13)14-9-5-6-10-16(14)19-12/h2-10H,11H2,1H3,(H,20,21)/p-1
SMILES:Cc1c(CC(=O)[O-])c(c2ccccc2)c2ccccc2n1
Synonyms:- (2-Methyl-4-Phenylquinolin-3-Yl)Acetic Acid
- (2-Methyl-4-Phenylquinolinium-3-Yl)Acetate
- (2-Methyl-4-Phenylquinolin-3-Yl)Acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-Methyl-4-phenylquinolin-3-yl)acetic acid hydrochloride
CAS:Formula:C18H16ClNO2Molecular weight:313.7781
