CymitQuimica logo

CAS 174063-92-4

:

S-methyl-L-thiocitrulline acetate

Description:
S-methyl-L-thiocitrulline acetate is a chemical compound that belongs to the class of amino acids and derivatives. It is characterized by the presence of a thiol group, which contributes to its unique reactivity and potential biological activity. The compound features a methyl group attached to the sulfur atom, which can influence its solubility and interaction with biological systems. As an acetate, it also contains an acetyl group, which can enhance its stability and bioavailability. S-methyl-L-thiocitrulline acetate is of interest in biochemical research, particularly in studies related to nitric oxide synthesis and metabolic pathways involving arginine and citrulline. Its structural characteristics may allow it to act as a substrate or inhibitor in various enzymatic reactions. Additionally, the compound's potential applications in pharmacology and nutrition are being explored, particularly in relation to cardiovascular health and metabolic disorders. Overall, S-methyl-L-thiocitrulline acetate represents a fascinating area of study within the field of biochemistry and medicinal chemistry.
Formula:C9H19N3O4S
InChI:InChI=1/C7H15N3O2S.C2H4O2/c1-13-7(9)10-4-2-3-5(8)6(11)12;1-2(3)4/h5H,2-4,8H2,1H3,(H2,9,10)(H,11,12);1H3,(H,3,4)/t5-;/m0./s1
SMILES:CSC(=N)NCCC[C@@H](C(=O)O)N.CC(=O)O
Synonyms:
  • (Z)-N~5~-[amino(methylsulfanyl)methylidene]-L-ornithine acetate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.