CAS 17408-14-9
:1-[2-(Trifluoromethyl)phenyl]ethanone
Description:
1-[2-(Trifluoromethyl)phenyl]ethanone, also known by its CAS number 17408-14-9, is an organic compound characterized by the presence of a trifluoromethyl group attached to a phenyl ring, along with a ketone functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its distinctive chemical properties, including a relatively high polarity due to the electronegative fluorine atoms, which can influence its reactivity and interactions with other substances. The trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, 1-[2-(Trifluoromethyl)phenyl]ethanone may exhibit unique spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and analysis. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H7F3O
InChI:InChI=1S/C9H7F3O/c1-6(13)7-4-2-3-5-8(7)9(10,11)12/h2-5H,1H3
InChI key:InChIKey=FYDUUODXZQITBF-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C(C)=O)C=CC=C1
Synonyms:- 1-(2-Trifluoromethylphenyl)ethanone
- 1-[2-(Trifluoromethyl)phenyl]ethan-1-one
- 1-[2-(Trifluoromethyl)phenyl]ethanone
- Acetophenone, 2′-(trifluoromethyl)-
- Ethanone, 1-[2-(trifluoromethyl)phenyl]-
- o-Trifluoromethylacetophenone
- o-Trifluoromethylphenyl methyl ketone
- 2-(Trifluoromethyl)acetophenone
- 2'-(Trifluoromethyl)-Acetophenone
- 2′-(Trifluoromethyl)acetophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethanone, 1-[2-(trifluoromethyl)phenyl]-
CAS:Formula:C9H7F3OPurity:98%Color and Shape:LiquidMolecular weight:188.14652'-(Trifluoromethyl)acetophenone
CAS:2'-(Trifluoromethyl)acetophenoneFormula:C9H7F3OPurity:98%Color and Shape: colourless to light yellow liquidMolecular weight:188.14648g/mol2'-(Trifluoromethyl)acetophenone
CAS:Formula:C9H7F3OPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:188.152′-(Trifluoromethyl)acetophenone
CAS:Formula:C9H7F3OPurity:98%Color and Shape:Low Melting SolidMolecular weight:188.1492'-(Trifluoromethyl)acetophenone
CAS:2'-(Trifluoromethyl)acetophenone is a ruthenium complex that is used in mechanistic studies of the mechanisms of organic reactions. This compound has been shown to be an effective catalyst for the reaction between aldehydes and chlorides, resulting in bond cleavage without the formation of byproducts. The mechanism of this reaction has been found to be through a concerted process involving c-H activation and subsequent bond cleavage. Molecular modeling studies show that 2'-(Trifluoromethyl)acetophenone binds to the carbonyl group, which provides additional stabilization and prevents unwanted side reactions.
Formula:C9H7F3OPurity:Min. 95%Molecular weight:188.15 g/mol





