CAS 174139-72-1

4H-Thieno[3,2-e]-1,2-thiazin-4-one, 6-chloro-2,3-dihydro-2-(3-methoxypropyl)-, 1,1-dioxide

Description:

4H-Thieno[3,2-e]-1,2-thiazin-4-one, 6-chloro-2,3-dihydro-2-(3-methoxypropyl)-, 1,1-dioxide, identified by CAS number 174139-72-1, is a heterocyclic compound featuring a thieno-thiazinone core structure. This compound is characterized by the presence of a chlorine atom and a methoxypropyl substituent, which contribute to its unique chemical properties. The thiazine ring system imparts notable stability and reactivity, making it of interest in medicinal chemistry and drug development. The presence of the 1,1-dioxide functional group indicates that it may exhibit specific reactivity patterns, such as potential oxidation or coordination with metal ions. Additionally, the methoxy group can enhance lipophilicity, potentially influencing the compound's bioavailability and pharmacokinetics. Overall, this compound's structural features suggest it may possess biological activity, warranting further investigation for potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₂ClNO₄S₂

InChI: InChI=1S/C10H12ClNO4S2/c1-16-4-2-3-12-6-8(13)7-5-9(11)17-10(7)18(12,14)15/h5H,2-4,6H2,1H3

InChI key: InChIKey=ZMPQRODWIGQDNJ-UHFFFAOYSA-N

SMILES: O=S1(=O)C2=C(C(=O)CN1CCCOC)C=C(Cl)S2

Synonyms:

• 4H-Thieno[3,2-e]-1,2-thiazin-4-one, 6-chloro-2,3-dihydro-2-(3-methoxypropyl)-, 1,1-dioxide

Brinzolamide Impurity 22

CAS: 174139-72-1

Formula: C₁₀H₁₂ClNO₄S₂

Molecular weight: 309.78

Ref: 4Z-B-2032