CymitQuimica logo

CAS 174139-72-1

:

4H-Thieno[3,2-e]-1,2-thiazin-4-one, 6-chloro-2,3-dihydro-2-(3-methoxypropyl)-, 1,1-dioxide

Description:
4H-Thieno[3,2-e]-1,2-thiazin-4-one, 6-chloro-2,3-dihydro-2-(3-methoxypropyl)-, 1,1-dioxide, identified by CAS number 174139-72-1, is a heterocyclic compound featuring a thieno-thiazinone core structure. This compound is characterized by the presence of a chlorine atom and a methoxypropyl substituent, which contribute to its unique chemical properties. The thiazine ring system imparts notable stability and reactivity, making it of interest in medicinal chemistry and drug development. The presence of the 1,1-dioxide functional group indicates that it may exhibit specific reactivity patterns, such as potential oxidation or coordination with metal ions. Additionally, the methoxy group can enhance lipophilicity, potentially influencing the compound's bioavailability and pharmacokinetics. Overall, this compound's structural features suggest it may possess biological activity, warranting further investigation for potential applications in pharmaceuticals or agrochemicals.
Formula:C10H12ClNO4S2
InChI:InChI=1S/C10H12ClNO4S2/c1-16-4-2-3-12-6-8(13)7-5-9(11)17-10(7)18(12,14)15/h5H,2-4,6H2,1H3
InChI key:InChIKey=ZMPQRODWIGQDNJ-UHFFFAOYSA-N
SMILES:O=S1(=O)C2=C(C(=O)CN1CCCOC)C=C(Cl)S2
Synonyms:
  • 4H-Thieno[3,2-e]-1,2-thiazin-4-one, 6-chloro-2,3-dihydro-2-(3-methoxypropyl)-, 1,1-dioxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.