CAS 174232-42-9
:Andrastin A
Description:
Andrastin A is a natural compound classified as a steroidal alkaloid, primarily derived from the plant species of the genus *Rauvolfia*. It is characterized by its complex tetracyclic structure, which includes a fused ring system typical of many alkaloids. This compound exhibits a range of biological activities, including potential anti-cancer and anti-inflammatory properties, making it a subject of interest in pharmacological research. Andrastin A has been shown to interact with various biological targets, influencing cellular processes and signaling pathways. Its mechanism of action often involves modulation of specific receptors or enzymes, contributing to its therapeutic potential. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in both laboratory and clinical settings. As research continues, Andrastin A may provide insights into new therapeutic strategies and the development of novel drugs.
Formula:C28H38O7
InChI:InChI=1S/C28H38O7/c1-15-13-19-25(6,28(23(33)34-8)22(32)16(2)21(31)26(15,28)7)11-9-18-24(4,5)20(35-17(3)30)10-12-27(18,19)14-29/h13-14,16,18-20H,9-12H2,1-8H3/t16?,18-,19-,20+,25+,26+,27+,28-/m1/s1
InChI key:InChIKey=GRBXNADBNJGZRK-GJEDHNSHSA-N
SMILES:C(OC)(=O)[C@]12[C@]3(C)[C@]([C@@]4(C=O)[C@](CC3)(C(C)(C)[C@@H](OC(C)=O)CC4)[H])(C=C(C)[C@@]1(C)C(=O)C(C)C2=O)[H]
Synonyms:- Androst-11-ene-14-carboxylic acid, 3-(acetyloxy)-4,4,8,12,16-pentamethyl-15,17,19-trioxo-, methyl ester, (3β,5β,8α,9β,10α,13α)-
- NSC 697452
- Andrastin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Androst-11-ene-14-carboxylic acid, 3-(acetyloxy)-4,4,8,12,16-pentamethyl-15,17,19-trioxo-, methyl ester, (3β,5β,8α,9β,10α,13α)-
CAS:Formula:C28H38O7Molecular weight:486.5971Andrastin A
CAS:<p>Andrastin A is a useful organic compound for research related to life sciences. The catalog number is T125574 and the CAS number is 174232-42-9.</p>Formula:C28H38O7Color and Shape:SolidMolecular weight:486.605


