CymitQuimica logo

CAS 174264-47-2

:

[6-{[tert-butyl(dimethyl)silyl]oxy}-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl][4-(2-piperidin-1-ylethoxy)phenyl]methanone

Description:
The chemical substance with the name "[6-{[tert-butyl(dimethyl)silyl]oxy}-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl][4-(2-piperidin-1-ylethoxy)phenyl]methanone" and CAS number "174264-47-2" is a complex organic compound characterized by its unique structural features. It contains a benzothiophene core, which is a fused ring system that contributes to its aromatic properties and potential biological activity. The presence of a tert-butyl(dimethyl)silyl group suggests that the compound may exhibit enhanced stability and lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the hydroxyl group on the phenyl ring may impart hydrogen bonding capabilities, potentially affecting its interaction with biological targets. The piperidine moiety indicates that the compound may have pharmacological relevance, possibly acting as a ligand for various receptors. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activity and properties would require empirical investigation.
Formula:C34H41NO4SSi
InChI:InChI=1/C34H41NO4SSi/c1-34(2,3)41(4,5)39-28-17-18-29-30(23-28)40-33(25-9-13-26(36)14-10-25)31(29)32(37)24-11-15-27(16-12-24)38-22-21-35-19-7-6-8-20-35/h9-18,23,36H,6-8,19-22H2,1-5H3
SMILES:CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)sc(c1ccc(cc1)O)c2C(=O)c1ccc(cc1)OCCN1CCCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.